C24H18O9 — CID 162801086
2-(3-acetyl-4,6-dihydroxy-2-methoxyphenyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione (PubChem CID 162801086) has the molecular formula C24H18O9 and a molecular weight of 450.40 g/mol. Its IUPAC name is 2-(3-acetyl-4,6-dihydroxy-2-methoxyphenyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione.
| Compound Name | 2-(3-acetyl-4,6-dihydroxy-2-methoxyphenyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 162801086 |
| Molecular Formula | C24H18O9 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-(3-acetyl-4,6-dihydroxy-2-methoxyphenyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| SMILES | COc1c(C(C)=O)c(O)cc(O)c1-c1c(CO)cc2c(c1O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C24H18O9/c1-9(26)16-14(28)7-15(29)20(24(16)33-2)17-10(8-25)6-12-19(22(17)31)23(32)18-11(21(12)30)4-3-5-13(18)27/h3-7,25,27-29,31H,8H2,1-2H3 |
| InChIKey | ACQLGCBPWJFPIM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|