C31H28O8 — CID 162897641
(6bS,10S,10aS,11R)-10-(3,4-dihydroxyphenyl)-5-hydroxy-11-(4-hydroxy-2-methoxyphenyl)-6-methoxy-8-methyl-9,10,10a,11-tetrahydro-6bH-indeno[2,1-f]chromen-3-one (PubChem CID 162897641) has the molecular formula C31H28O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is (6bS,10S,10aS,11R)-10-(3,4-dihydroxyphenyl)-5-hydroxy-11-(4-hydroxy-2-methoxyphenyl)-6-methoxy-8-methyl-9,10,10a,11-tetrahydro-6bH-indeno[2,1-f]chromen-3-one.
| Compound Name | (6bS,10S,10aS,11R)-10-(3,4-dihydroxyphenyl)-5-hydroxy-11-(4-hydroxy-2-methoxyphenyl)-6-methoxy-8-methyl-9,10,10a,11-tetrahydro-6bH-indeno[2,1-f]chromen-3-one |
|---|---|
| PubChem CID | 162897641 |
| Molecular Formula | C31H28O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (6bS,10S,10aS,11R)-10-(3,4-dihydroxyphenyl)-5-hydroxy-11-(4-hydroxy-2-methoxyphenyl)-6-methoxy-8-methyl-9,10,10a,11-tetrahydro-6bH-indeno[2,1-f]chromen-3-one |
| SMILES | COc1cc(O)ccc1[C@H]1c2c(c(OC)c(O)c3oc(=O)ccc23)[C@@H]2C=C(C)C[C@H](c3ccc(O)c(O)c3)[C@H]12 |
| InChI | InChI=1S/C31H28O8/c1-14-10-19(15-4-8-21(33)22(34)12-15)25-20(11-14)28-27(26(25)17-6-5-16(32)13-23(17)37-2)18-7-9-24(35)39-30(18)29(36)31(28)38-3/h4-9,11-13,19-20,25-26,32-34,36H,10H2,1-3H3/t19-,20-,25+,26-/m1/s1 |
| InChIKey | VVNFKFOTGIYXOX-RORGBTKSSA-N |
| XLogP | 5.61 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|