C30H26O6 — CID 162917895
(4R,4aS,5S,12bS)-4-(4-hydroxy-2-methoxyphenyl)-5-(4-hydroxyphenyl)-2-methyl-4,4a,5,12b-tetrahydro-3H-isochromeno[4,3-g]chromen-9-one (PubChem CID 162917895) has the molecular formula C30H26O6 and a molecular weight of 482.53 g/mol. Its IUPAC name is (4R,4aS,5S,12bS)-4-(4-hydroxy-2-methoxyphenyl)-5-(4-hydroxyphenyl)-2-methyl-4,4a,5,12b-tetrahydro-3H-isochromeno[4,3-g]chromen-9-one.
| Compound Name | (4R,4aS,5S,12bS)-4-(4-hydroxy-2-methoxyphenyl)-5-(4-hydroxyphenyl)-2-methyl-4,4a,5,12b-tetrahydro-3H-isochromeno[4,3-g]chromen-9-one |
|---|---|
| PubChem CID | 162917895 |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (4R,4aS,5S,12bS)-4-(4-hydroxy-2-methoxyphenyl)-5-(4-hydroxyphenyl)-2-methyl-4,4a,5,12b-tetrahydro-3H-isochromeno[4,3-g]chromen-9-one |
| SMILES | COc1cc(O)ccc1[C@@H]1CC(C)=C[C@@H]2c3cc4ccc(=O)oc4cc3O[C@H](c3ccc(O)cc3)[C@H]21 |
| InChI | InChI=1S/C30H26O6/c1-16-11-23(21-9-8-20(32)14-26(21)34-2)29-24(12-16)22-13-18-5-10-28(33)35-25(18)15-27(22)36-30(29)17-3-6-19(31)7-4-17/h3-10,12-15,23-24,29-32H,11H2,1-2H3/t23-,24+,29-,30+/m0/s1 |
| InChIKey | YECGSLHMDGBPTB-YENCJLLLSA-N |
| XLogP | 6.18 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|