C25H30O4 — CID 162905079
2-(2,6-dimethylhepta-1,5-dienyl)-4-ethenyl-7-hydroxy-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one (PubChem CID 162905079) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-(2,6-dimethylhepta-1,5-dienyl)-4-ethenyl-7-hydroxy-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one.
| Compound Name | 2-(2,6-dimethylhepta-1,5-dienyl)-4-ethenyl-7-hydroxy-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 162905079 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-(2,6-dimethylhepta-1,5-dienyl)-4-ethenyl-7-hydroxy-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one |
| SMILES | C=CC1(C)CC(C=C(C)CCC=C(C)C)Oc2c1c(=O)oc1c(O)ccc(C)c21 |
| InChI | InChI=1S/C25H30O4/c1-7-25(6)14-18(13-16(4)10-8-9-15(2)3)28-23-20-17(5)11-12-19(26)22(20)29-24(27)21(23)25/h7,9,11-13,18,26H,1,8,10,14H2,2-6H3 |
| InChIKey | YYTDIFAVQFQGAJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|