C28H42O8 — CID 162967319
[(3R,3aS,4S,6E,8R,9R,10R,11E,12aR)-8,9-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-4-yl] acetate (PubChem CID 162967319) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is [(3R,3aS,4S,6E,8R,9R,10R,11E,12aR)-8,9-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-4-yl] acetate.
| Compound Name | [(3R,3aS,4S,6E,8R,9R,10R,11E,12aR)-8,9-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-4-yl] acetate |
|---|---|
| PubChem CID | 162967319 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [(3R,3aS,4S,6E,8R,9R,10R,11E,12aR)-8,9-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)/C=C/[C@@]2(C)CC[C@@H](C(C)(C)OC(C)=O)[C@@H]2[C@@H](OC(C)=O)C/C(C)=C/[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H42O8/c1-16-14-23(33-18(3)29)25-22(27(7,8)36-21(6)32)11-13-28(25,9)12-10-17(2)26(35-20(5)31)24(15-16)34-19(4)30/h10,12,15,17,22-26H,11,13-14H2,1-9H3/b12-10+,16-15+/t17-,22-,23+,24-,25-,26-,28+/m1/s1 |
| InChIKey | IEVRTRFLEIOJRN-IAMQDYACSA-N |
| XLogP | 4.70 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|