C25H26O11 — CID 162982911
[(3S,3aR,6R,6aS)-3-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-6-(4-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate (PubChem CID 162982911) has the molecular formula C25H26O11 and a molecular weight of 502.47 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-6-(4-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate.
| Compound Name | [(3S,3aR,6R,6aS)-3-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-6-(4-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
|---|---|
| PubChem CID | 162982911 |
| Molecular Formula | C25H26O11 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-6-(4-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
| SMILES | COc1cc2c(c(OC)c1[C@@H]1OC[C@H]3[C@H](c4ccc5c(c4OC)OCO5)OC[C@@]13OC(C)=O)OCO2 |
| InChI | InChI=1S/C25H26O11/c1-12(26)36-25-9-31-19(13-5-6-15-21(20(13)28-3)34-10-32-15)14(25)8-30-24(25)18-16(27-2)7-17-22(23(18)29-4)35-11-33-17/h5-7,14,19,24H,8-11H2,1-4H3/t14-,19-,24-,25-/m0/s1 |
| InChIKey | RAEVVXDSRIMUNE-FMEVNECASA-N |
| XLogP | 2.93 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |