C34H42O6 — CID 163015087
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(2S)-6-hydroxy-8-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]-5-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 163015087) has the molecular formula C34H42O6 and a molecular weight of 546.70 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(2S)-6-hydroxy-8-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]-5-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(2S)-6-hydroxy-8-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]-5-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 163015087 |
| Molecular Formula | C34H42O6 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(2S)-6-hydroxy-8-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]-5-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(c2c(O)cc(OC)c3c2C=C[C@](C)(CCC=C(C)C)O3)=C(C/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C34H42O6/c1-21(2)11-9-13-23(5)14-15-24-30(26(35)19-28(38-7)32(24)37)31-25-16-18-34(6,17-10-12-22(3)4)40-33(25)29(39-8)20-27(31)36/h11-12,14,16,18-20,36H,9-10,13,15,17H2,1-8H3/b23-14+/t34-/m0/s1 |
| InChIKey | AORYWSYWEOYHNS-PUTAPQLPSA-N |
| XLogP | 7.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|