C24H40N2O — CID 163048392
8-(dimethylamino)-5,17,18-trimethyl-18-azapentacyclo[14.3.1.01,14.04,13.05,10]icos-10-en-2-ol (PubChem CID 163048392) has the molecular formula C24H40N2O and a molecular weight of 372.60 g/mol. Its IUPAC name is 8-(dimethylamino)-5,17,18-trimethyl-18-azapentacyclo[14.3.1.01,14.04,13.05,10]icos-10-en-2-ol.
| Compound Name | 8-(dimethylamino)-5,17,18-trimethyl-18-azapentacyclo[14.3.1.01,14.04,13.05,10]icos-10-en-2-ol |
|---|---|
| PubChem CID | 163048392 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | 8-(dimethylamino)-5,17,18-trimethyl-18-azapentacyclo[14.3.1.01,14.04,13.05,10]icos-10-en-2-ol |
| SMILES | CC1C2CC3C4CC=C5CC(N(C)C)CCC5(C)C4CC(O)C3(C2)CN1C |
| InChI | InChI=1S/C24H40N2O/c1-15-16-10-21-19-7-6-17-11-18(25(3)4)8-9-23(17,2)20(19)12-22(27)24(21,13-16)14-26(15)5/h6,15-16,18-22,27H,7-14H2,1-5H3 |
| InChIKey | GYABRMDCDGXMRC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|