C17H13NO3 — CID 163121458
15,16-dihydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),12,14-heptaen-8-one (PubChem CID 163121458) has the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. Its IUPAC name is 15,16-dihydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),12,14-heptaen-8-one.
| Compound Name | 15,16-dihydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),12,14-heptaen-8-one |
|---|---|
| PubChem CID | 163121458 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 15,16-dihydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),12,14-heptaen-8-one |
| SMILES | CN1CC=c2cc(O)c(O)c3c2=C1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C17H13NO3/c1-18-7-6-9-8-12(19)17(21)14-10-4-2-3-5-11(10)16(20)15(18)13(9)14/h2-6,8,19,21H,7H2,1H3 |
| InChIKey | HKBXQKOZOPCELY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|