C22H27BO4S — CID 163284711
2-(9,9-dimethyl-7-methylsulfonylfluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 163284711) has the molecular formula C22H27BO4S and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(9,9-dimethyl-7-methylsulfonylfluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(9,9-dimethyl-7-methylsulfonylfluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163284711 |
| Molecular Formula | C22H27BO4S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-(9,9-dimethyl-7-methylsulfonylfluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2cc(S(C)(=O)=O)ccc2-c2c(B3OC(C)(C)C(C)(C)O3)cccc21 |
| InChI | InChI=1S/C22H27BO4S/c1-20(2)16-9-8-10-18(23-26-21(3,4)22(5,6)27-23)19(16)15-12-11-14(13-17(15)20)28(7,24)25/h8-13H,1-7H3 |
| InChIKey | SVMVZSCNAAIUNN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|