C18H23BrClFN2O4S — CID 163391707
tert-butyl (3S)-4-(4-bromo-5-chloro-2-fluoro-3-sulfanylbenzoyl)-3-(2-hydroxyethyl)piperazine-1-carboxylate (PubChem CID 163391707) has the molecular formula C18H23BrClFN2O4S and a molecular weight of 497.81 g/mol. Its IUPAC name is tert-butyl (3S)-4-(4-bromo-5-chloro-2-fluoro-3-sulfanylbenzoyl)-3-(2-hydroxyethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(4-bromo-5-chloro-2-fluoro-3-sulfanylbenzoyl)-3-(2-hydroxyethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163391707 |
| Molecular Formula | C18H23BrClFN2O4S |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | tert-butyl (3S)-4-(4-bromo-5-chloro-2-fluoro-3-sulfanylbenzoyl)-3-(2-hydroxyethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cc(Cl)c(Br)c(S)c2F)[C@@H](CCO)C1 |
| InChI | InChI=1S/C18H23BrClFN2O4S/c1-18(2,3)27-17(26)22-5-6-23(10(9-22)4-7-24)16(25)11-8-12(20)13(19)15(28)14(11)21/h8,10,24,28H,4-7,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | ZDUOJQANDNLBCK-JTQLQIEISA-N |
| XLogP | 3.97 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|