C40H40N4O8S — CID 163435885
N-[4-[6-[(5-cyclohexa-1,3,4-trien-1-yl-4-phenyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-(4-nitrophenyl)-1,3-dioxan-4-yl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 163435885) has the molecular formula C40H40N4O8S and a molecular weight of 736.85 g/mol. Its IUPAC name is N-[4-[6-[(5-cyclohexa-1,3,4-trien-1-yl-4-phenyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-(4-nitrophenyl)-1,3-dioxan-4-yl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[6-[(5-cyclohexa-1,3,4-trien-1-yl-4-phenyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-(4-nitrophenyl)-1,3-dioxan-4-yl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 163435885 |
| Molecular Formula | C40H40N4O8S |
| Molecular Weight | 736.85 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | N-[4-[6-[(5-cyclohexa-1,3,4-trien-1-yl-4-phenyl-1,3-oxazol-2-yl)sulfanylmethyl]-2-(4-nitrophenyl)-1,3-dioxan-4-yl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(C2CC(CSc3nc(-c4ccccc4)c(C4=CC=C=CC4)o3)OC(c3ccc([N+](=O)[O-])cc3)O2)cc1)NO |
| InChI | InChI=1S/C40H40N4O8S/c45-35(15-9-1-2-10-16-36(46)43-47)41-31-21-17-27(18-22-31)34-25-33(50-39(51-34)30-19-23-32(24-20-30)44(48)49)26-53-40-42-37(28-11-5-3-6-12-28)38(52-40)29-13-7-4-8-14-29/h3,5-8,11-13,17-24,33-34,39,47H,1-2,9-10,14-16,25-26H2,(H,41,45)(H,43,46) |
| InChIKey | AULQAALZLMVGRX-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.85 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|