C25H32N6O2 — CID 163467926
4-[[4-(aminomethyl)cyclohexyl]methylamino]-N-hydroxy-2-[(2-phenylphenyl)methylamino]pyrimidin-5-amine oxide (PubChem CID 163467926) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)cyclohexyl]methylamino]-N-hydroxy-2-[(2-phenylphenyl)methylamino]pyrimidin-5-amine oxide.
| Compound Name | 4-[[4-(aminomethyl)cyclohexyl]methylamino]-N-hydroxy-2-[(2-phenylphenyl)methylamino]pyrimidin-5-amine oxide |
|---|---|
| PubChem CID | 163467926 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 4-[[4-(aminomethyl)cyclohexyl]methylamino]-N-hydroxy-2-[(2-phenylphenyl)methylamino]pyrimidin-5-amine oxide |
| SMILES | NCC1CCC(CNc2nc(NCc3ccccc3-c3ccccc3)ncc2[NH+]([O-])O)CC1 |
| InChI | InChI=1S/C25H32N6O2/c26-14-18-10-12-19(13-11-18)15-27-24-23(31(32)33)17-29-25(30-24)28-16-21-8-4-5-9-22(21)20-6-2-1-3-7-20/h1-9,17-19,31-32H,10-16,26H2,(H2,27,28,29,30) |
| InChIKey | BUEPZGJWCMEBPD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|