C11H18O3Si — CID 163501112
[3-(6-hydroxycyclohexa-2,4-dien-1-yl)propyl-methoxysilyl]formaldehyde (PubChem CID 163501112) has the molecular formula C11H18O3Si and a molecular weight of 226.35 g/mol. Its IUPAC name is [3-(6-hydroxycyclohexa-2,4-dien-1-yl)propyl-methoxysilyl]formaldehyde.
| Compound Name | [3-(6-hydroxycyclohexa-2,4-dien-1-yl)propyl-methoxysilyl]formaldehyde |
|---|---|
| PubChem CID | 163501112 |
| Molecular Formula | C11H18O3Si |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | [3-(6-hydroxycyclohexa-2,4-dien-1-yl)propyl-methoxysilyl]formaldehyde |
| SMILES | CO[SiH](C=O)CCCC1C=CC=CC1O |
| InChI | InChI=1S/C11H18O3Si/c1-14-15(9-12)8-4-6-10-5-2-3-7-11(10)13/h2-3,5,7,9-11,13,15H,4,6,8H2,1H3 |
| InChIKey | CUUOJQRWFDFVCB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|