C26H37N3O7 — CID 163536431
(4S,4aS,5aS,12aR)-7-(aminomethyl)-9-tert-butyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6,6a,7-octahydro-2H-tetracene-2-carboxamide (PubChem CID 163536431) has the molecular formula C26H37N3O7 and a molecular weight of 503.60 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-7-(aminomethyl)-9-tert-butyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6,6a,7-octahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-7-(aminomethyl)-9-tert-butyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6,6a,7-octahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163536431 |
| Molecular Formula | C26H37N3O7 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (4S,4aS,5aS,12aR)-7-(aminomethyl)-9-tert-butyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6,6a,7-octahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)C4=C(O)C(C(C)(C)C)=CC(CN)C4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H37N3O7/c1-25(2,3)14-8-11(9-27)12-6-10-7-13-18(29(4)5)21(32)17(24(28)35)23(34)26(13,36)22(33)15(10)20(31)16(12)19(14)30/h8,10-13,17-18,21,30-32,36H,6-7,9,27H2,1-5H3,(H2,28,35)/t10-,11?,12?,13-,17?,18-,21?,26-/m0/s1 |
| InChIKey | WHIQOGUGSILGFV-HQBKTKIZSA-N |
| XLogP | 0.10 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|