C41H50N2O5 — CID 163624353
cyclopentyl 2-[2-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzoyl]-2-[(Z)-2-methylidenepent-3-enyl]hydrazinyl]-4-methylpentanoate (PubChem CID 163624353) has the molecular formula C41H50N2O5 and a molecular weight of 650.86 g/mol. Its IUPAC name is cyclopentyl 2-[2-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzoyl]-2-[(Z)-2-methylidenepent-3-enyl]hydrazinyl]-4-methylpentanoate.
| Compound Name | cyclopentyl 2-[2-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzoyl]-2-[(Z)-2-methylidenepent-3-enyl]hydrazinyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 163624353 |
| Molecular Formula | C41H50N2O5 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | cyclopentyl 2-[2-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzoyl]-2-[(Z)-2-methylidenepent-3-enyl]hydrazinyl]-4-methylpentanoate |
| SMILES | C=C(/C=C\C)CN(NC(CC(C)C)C(=O)OC1CCCC1)C(=O)c1cc(C(=C)C)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C41H50N2O5/c1-7-16-31(6)26-43(42-37(23-29(2)3)41(45)48-34-21-14-15-22-34)40(44)36-24-35(30(4)5)38(46-27-32-17-10-8-11-18-32)25-39(36)47-28-33-19-12-9-13-20-33/h7-13,16-20,24-25,29,34,37,42H,4,6,14-15,21-23,26-28H2,1-3,5H3/b16-7- |
| InChIKey | HQVGBHGLKIHDPX-APSNUPSMSA-N |
| XLogP | 8.86 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|