C25H37NO2Si — CID 163626515
tert-butyl 2-[[benzyl-[(1S)-1-phenylethyl]amino]-butylsilyl]acetate (PubChem CID 163626515) has the molecular formula C25H37NO2Si and a molecular weight of 411.66 g/mol. Its IUPAC name is tert-butyl 2-[[benzyl-[(1S)-1-phenylethyl]amino]-butylsilyl]acetate.
| Compound Name | tert-butyl 2-[[benzyl-[(1S)-1-phenylethyl]amino]-butylsilyl]acetate |
|---|---|
| PubChem CID | 163626515 |
| Molecular Formula | C25H37NO2Si |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | tert-butyl 2-[[benzyl-[(1S)-1-phenylethyl]amino]-butylsilyl]acetate |
| SMILES | CCCC[Si@@H](CC(=O)OC(C)(C)C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H37NO2Si/c1-6-7-18-29(20-24(27)28-25(3,4)5)26(19-22-14-10-8-11-15-22)21(2)23-16-12-9-13-17-23/h8-17,21,29H,6-7,18-20H2,1-5H3/t21-,29-/m0/s1 |
| InChIKey | HSMNWJOMCZNJEO-LGGPFLRQSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|