C17H36N4O5 — CID 163630060
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-4,5,6-trihydroxy-3-methyloxane-2-carboxamide (PubChem CID 163630060) has the molecular formula C17H36N4O5 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-4,5,6-trihydroxy-3-methyloxane-2-carboxamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-4,5,6-trihydroxy-3-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 163630060 |
| Molecular Formula | C17H36N4O5 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-4,5,6-trihydroxy-3-methyloxane-2-carboxamide |
| SMILES | CC1C(C(=O)NCCCNCCCCNCCCN)OC(O)C(O)C1O |
| InChI | InChI=1S/C17H36N4O5/c1-12-13(22)14(23)17(25)26-15(12)16(24)21-11-5-10-20-8-3-2-7-19-9-4-6-18/h12-15,17,19-20,22-23,25H,2-11,18H2,1H3,(H,21,24) |
| InChIKey | HVHWNCSARZXTQB-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|