C34H60N3O13P3Si3 — CID 163675321
bis(trimethylsilyloxy)phosphoryl [[[(2R,3R,5R)-3-ethoxy-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]-hex-5-ynoxyphosphoryl] trimethylsilyl phosphate (PubChem CID 163675321) has the molecular formula C34H60N3O13P3Si3 and a molecular weight of 896.04 g/mol. Its IUPAC name is bis(trimethylsilyloxy)phosphoryl [[[(2R,3R,5R)-3-ethoxy-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]-hex-5-ynoxyphosphoryl] trimethylsilyl phosphate.
| Compound Name | bis(trimethylsilyloxy)phosphoryl [[[(2R,3R,5R)-3-ethoxy-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]-hex-5-ynoxyphosphoryl] trimethylsilyl phosphate |
|---|---|
| PubChem CID | 163675321 |
| Molecular Formula | C34H60N3O13P3Si3 |
| Molecular Weight | 896.04 g/mol |
| Exact Mass | 895.26 |
| IUPAC Name | bis(trimethylsilyloxy)phosphoryl [[[(2R,3R,5R)-3-ethoxy-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylamino]-hex-5-ynoxyphosphoryl] trimethylsilyl phosphate |
| SMILES | C#CCCCCC#Cc1cn([C@H]2C[C@@H](OCC)[C@@H](CNP(=O)(OCCCCC#C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H60N3O13P3Si3/c1-13-16-18-20-21-22-24-29-28-37(34(39)36-33(29)38)32-26-30(43-15-3)31(45-32)27-35-51(40,44-25-23-19-17-14-2)46-52(41,48-54(4,5)6)47-53(42,49-55(7,8)9)50-56(10,11)12/h1-2,28,30-32H,15-21,23,25-27H2,3-12H3,(H,35,40)(H,36,38,39)/t30-,31-,32-,51?,52?/m1/s1 |
| InChIKey | WOCSJRAIZHPJPZ-SFADVYPDSA-N |
| XLogP | 8.10 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.04 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|