C20H16Cl3N4O3S- — CID 163688711
3-[hydroxy(oxido)amino]-N-[2,2,2-trichloro-1-(naphthalen-2-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 163688711) has the molecular formula C20H16Cl3N4O3S- and a molecular weight of 498.80 g/mol. Its IUPAC name is 3-[hydroxy(oxido)amino]-N-[2,2,2-trichloro-1-(naphthalen-2-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 3-[hydroxy(oxido)amino]-N-[2,2,2-trichloro-1-(naphthalen-2-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 163688711 |
| Molecular Formula | C20H16Cl3N4O3S- |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | 3-[hydroxy(oxido)amino]-N-[2,2,2-trichloro-1-(naphthalen-2-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)Nc1ccc2ccccc2c1)C(Cl)(Cl)Cl)c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C20H16Cl3N4O3S/c21-20(22,23)18(25-17(28)14-6-3-7-16(11-14)27(29)30)26-19(31)24-15-9-8-12-4-1-2-5-13(12)10-15/h1-11,18,29H,(H,25,28)(H2,24,26,31)/q-1 |
| InChIKey | JGMNDUCQHSMDEB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|