C14H21ClO — CID 163701824
(1R,6S,7S,10R)-6-chloro-5-methoxy-11-methyltricyclo[8.1.1.02,7]dodec-8-ene (PubChem CID 163701824) has the molecular formula C14H21ClO and a molecular weight of 240.77 g/mol. Its IUPAC name is (1R,6S,7S,10R)-6-chloro-5-methoxy-11-methyltricyclo[8.1.1.02,7]dodec-8-ene.
| Compound Name | (1R,6S,7S,10R)-6-chloro-5-methoxy-11-methyltricyclo[8.1.1.02,7]dodec-8-ene |
|---|---|
| PubChem CID | 163701824 |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.77 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (1R,6S,7S,10R)-6-chloro-5-methoxy-11-methyltricyclo[8.1.1.02,7]dodec-8-ene |
| SMILES | COC1CCC2[C@@H]3C[C@H](C=C[C@@H]2[C@@H]1Cl)C3C |
| InChI | InChI=1S/C14H21ClO/c1-8-9-3-4-11-10(12(8)7-9)5-6-13(16-2)14(11)15/h3-4,8-14H,5-7H2,1-2H3/t8?,9-,10?,11-,12+,13?,14-/m0/s1 |
| InChIKey | KBRKNHSEGPADKO-ARZQSFKXSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|