C7H11INO5- — CID 163772112
(3S,5S)-4-aminooxy-6-ethynyliodanuidyloxane-2,3,5-triol (PubChem CID 163772112) has the molecular formula C7H11INO5- and a molecular weight of 316.07 g/mol. Its IUPAC name is (3S,5S)-4-aminooxy-6-ethynyliodanuidyloxane-2,3,5-triol.
| Compound Name | (3S,5S)-4-aminooxy-6-ethynyliodanuidyloxane-2,3,5-triol |
|---|---|
| PubChem CID | 163772112 |
| Molecular Formula | C7H11INO5- |
| Molecular Weight | 316.07 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | (3S,5S)-4-aminooxy-6-ethynyliodanuidyloxane-2,3,5-triol |
| SMILES | C#C[I-]C1OC(O)[C@@H](O)C(ON)[C@@H]1O |
| InChI | InChI=1S/C7H11INO5/c1-2-8-6-3(10)5(14-9)4(11)7(12)13-6/h1,3-7,10-12H,9H2/q-1/t3-,4-,5?,6?,7?/m0/s1 |
| InChIKey | DKJOGYYXUGRDSD-PWSZLAETSA-N |
| XLogP | -5.68 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.07 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|