C6H13NO6 — CID 91387854
(1S,2S,4R,5R)-6-aminooxycyclohexane-1,2,3,4,5-pentol (PubChem CID 91387854) has the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. Its IUPAC name is (1S,2S,4R,5R)-6-aminooxycyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,4R,5R)-6-aminooxycyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 91387854 |
| Molecular Formula | C6H13NO6 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (1S,2S,4R,5R)-6-aminooxycyclohexane-1,2,3,4,5-pentol |
| SMILES | NOC1[C@@H](O)[C@@H](O)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13NO6/c7-13-6-4(11)2(9)1(8)3(10)5(6)12/h1-6,8-12H,7H2/t1?,2-,3+,4-,5+,6? |
| InChIKey | BKUXMJZZACENOU-GQXJQEMDSA-N |
| XLogP | -3.94 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|