C6H14O6Si — CID 173358327
(1S,2S,4R,5S)-6-silyloxycyclohexane-1,2,3,4,5-pentol (PubChem CID 173358327) has the molecular formula C6H14O6Si and a molecular weight of 210.26 g/mol. Its IUPAC name is (1S,2S,4R,5S)-6-silyloxycyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,4R,5S)-6-silyloxycyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 173358327 |
| Molecular Formula | C6H14O6Si |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (1S,2S,4R,5S)-6-silyloxycyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@H](O)C(O[SiH3])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O6Si/c7-1-2(8)4(10)6(12-13)5(11)3(1)9/h1-11H,13H3/t1?,2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | ZOBFJUKTZYXECO-LXOASSSBSA-N |
| XLogP | -4.53 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|