C14H14S — CID 163800647
2-ethyl-3-methyl-2λ4-thiatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene (PubChem CID 163800647) has the molecular formula C14H14S and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-ethyl-3-methyl-2λ4-thiatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene.
| Compound Name | 2-ethyl-3-methyl-2λ4-thiatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene |
|---|---|
| PubChem CID | 163800647 |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-ethyl-3-methyl-2λ4-thiatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene |
| SMILES | CCS1=C(C)c2cccc3cccc1c23 |
| InChI | InChI=1S/C14H14S/c1-3-15-10(2)12-8-4-6-11-7-5-9-13(15)14(11)12/h4-9H,3H2,1-2H3 |
| InChIKey | NEQRCCYMHBWZCL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|