C12H11I — CID 163850423
4-(4-methylphenyl)-1λ3-iodacyclohexa-1,3,5-triene (PubChem CID 163850423) has the molecular formula C12H11I and a molecular weight of 282.12 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1λ3-iodacyclohexa-1,3,5-triene.
| Compound Name | 4-(4-methylphenyl)-1λ3-iodacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 163850423 |
| Molecular Formula | C12H11I |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 4-(4-methylphenyl)-1λ3-iodacyclohexa-1,3,5-triene |
| SMILES | Cc1ccc(C2=CC=IC=C2)cc1 |
| InChI | InChI=1S/C12H11I/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h2-9H,1H3 |
| InChIKey | OTXAROVHEWDLPP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|