C21H18F3N5OS — CID 163854384
N-(2,6-difluorophenyl)-2-(2-fluorophenyl)-9-(2-methylsulfanylethoxymethyl)purin-6-amine (PubChem CID 163854384) has the molecular formula C21H18F3N5OS and a molecular weight of 445.47 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(2-fluorophenyl)-9-(2-methylsulfanylethoxymethyl)purin-6-amine.
| Compound Name | N-(2,6-difluorophenyl)-2-(2-fluorophenyl)-9-(2-methylsulfanylethoxymethyl)purin-6-amine |
|---|---|
| PubChem CID | 163854384 |
| Molecular Formula | C21H18F3N5OS |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(2-fluorophenyl)-9-(2-methylsulfanylethoxymethyl)purin-6-amine |
| SMILES | CSCCOCn1cnc2c(Nc3c(F)cccc3F)nc(-c3ccccc3F)nc21 |
| InChI | InChI=1S/C21H18F3N5OS/c1-31-10-9-30-12-29-11-25-18-20(26-17-15(23)7-4-8-16(17)24)27-19(28-21(18)29)13-5-2-3-6-14(13)22/h2-8,11H,9-10,12H2,1H3,(H,26,27,28) |
| InChIKey | OXBQYEUYQJNQGI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|