C15H18 — CID 163882415
1-[(2Z,4E)-4-(cyclobuten-1-yl)hexa-2,4-dien-2-yl]cyclopenta-1,3-diene (PubChem CID 163882415) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(2Z,4E)-4-(cyclobuten-1-yl)hexa-2,4-dien-2-yl]cyclopenta-1,3-diene.
| Compound Name | 1-[(2Z,4E)-4-(cyclobuten-1-yl)hexa-2,4-dien-2-yl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 163882415 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-[(2Z,4E)-4-(cyclobuten-1-yl)hexa-2,4-dien-2-yl]cyclopenta-1,3-diene |
| SMILES | C/C=C(\C=C(\C)C1=CC=CC1)C1=CCC1 |
| InChI | InChI=1S/C15H18/c1-3-13(15-9-6-10-15)11-12(2)14-7-4-5-8-14/h3-5,7,9,11H,6,8,10H2,1-2H3/b12-11-,13-3+ |
| InChIKey | PUJUKDKYQPSQCD-CBYPMSROSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|