C19H18BNO5 — CID 163892777
furan-2-yl-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methylamino]methanol (PubChem CID 163892777) has the molecular formula C19H18BNO5 and a molecular weight of 351.17 g/mol. Its IUPAC name is furan-2-yl-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methylamino]methanol.
| Compound Name | furan-2-yl-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methylamino]methanol |
|---|---|
| PubChem CID | 163892777 |
| Molecular Formula | C19H18BNO5 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | furan-2-yl-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methylamino]methanol |
| SMILES | OB1OCc2cc(Oc3ccc(CNC(O)c4ccco4)cc3)ccc21 |
| InChI | InChI=1S/C19H18BNO5/c22-19(18-2-1-9-24-18)21-11-13-3-5-15(6-4-13)26-16-7-8-17-14(10-16)12-25-20(17)23/h1-10,19,21-23H,11-12H2 |
| InChIKey | QCZNRLHRKSQFRO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|