C26H31BrN5O6P — CID 163972712
9-[2-[[(3-bromophenyl)methoxy-[(5-cyclopentyl-2-methylidene-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-6-methylidene-1H-purin-2-amine (PubChem CID 163972712) has the molecular formula C26H31BrN5O6P and a molecular weight of 620.44 g/mol. Its IUPAC name is 9-[2-[[(3-bromophenyl)methoxy-[(5-cyclopentyl-2-methylidene-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-6-methylidene-1H-purin-2-amine.
| Compound Name | 9-[2-[[(3-bromophenyl)methoxy-[(5-cyclopentyl-2-methylidene-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-6-methylidene-1H-purin-2-amine |
|---|---|
| PubChem CID | 163972712 |
| Molecular Formula | C26H31BrN5O6P |
| Molecular Weight | 620.44 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | 9-[2-[[(3-bromophenyl)methoxy-[(5-cyclopentyl-2-methylidene-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-6-methylidene-1H-purin-2-amine |
| SMILES | C=C1OC(COP(=O)(COCCn2cnc3c2N=C(N)NC3=C)OCc2cccc(Br)c2)=C(C2CCCC2)O1 |
| InChI | InChI=1S/C26H31BrN5O6P/c1-17-23-25(31-26(28)30-17)32(15-29-23)10-11-34-16-39(33,35-13-19-6-5-9-21(27)12-19)36-14-22-24(38-18(2)37-22)20-7-3-4-8-20/h5-6,9,12,15,20H,1-4,7-8,10-11,13-14,16H2,(H3,28,30,31) |
| InChIKey | SRKSAEHFEUBVNW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|