C22H25ClN3O6S- — CID 163978081
1-[(5-chlorofuran-2-yl)-(oxan-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-oxidourea (PubChem CID 163978081) has the molecular formula C22H25ClN3O6S- and a molecular weight of 494.98 g/mol. Its IUPAC name is 1-[(5-chlorofuran-2-yl)-(oxan-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-oxidourea.
| Compound Name | 1-[(5-chlorofuran-2-yl)-(oxan-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-oxidourea |
|---|---|
| PubChem CID | 163978081 |
| Molecular Formula | C22H25ClN3O6S- |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-[(5-chlorofuran-2-yl)-(oxan-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-oxidourea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)N([O-])S(=O)(=O)N(c1ccc(Cl)o1)C1CCOCC1 |
| InChI | InChI=1S/C22H25ClN3O6S/c23-19-7-8-20(32-19)25(16-9-11-31-12-10-16)33(29,30)26(28)22(27)24-21-17-5-1-3-14(17)13-15-4-2-6-18(15)21/h7-8,13,16H,1-6,9-12H2,(H,24,27)/q-1 |
| InChIKey | IXZJYUWCGFLLMR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|