C63H115N3O9 — CID 164552751
7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(3-carbamoylpiperidin-1-yl)propyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate (PubChem CID 164552751) has the molecular formula C63H115N3O9 and a molecular weight of 1058.62 g/mol. Its IUPAC name is 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(3-carbamoylpiperidin-1-yl)propyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate.
| Compound Name | 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(3-carbamoylpiperidin-1-yl)propyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
|---|---|
| PubChem CID | 164552751 |
| Molecular Formula | C63H115N3O9 |
| Molecular Weight | 1058.62 g/mol |
| Exact Mass | 1057.86 |
| IUPAC Name | 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(3-carbamoylpiperidin-1-yl)propyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCCN(CCCCCCCOC(=O)CCC(OCCCC/C=C\CC)OCCCC/C=C\CC)CCCN1CCCC(C(N)=O)C1)OCCCC/C=C\CC |
| InChI | InChI=1S/C63H115N3O9/c1-5-9-13-17-25-35-53-72-61(73-54-36-26-18-14-10-6-2)44-42-59(67)70-51-33-29-21-23-31-46-65(49-40-50-66-48-39-41-58(57-66)63(64)69)47-32-24-22-30-34-52-71-60(68)43-45-62(74-55-37-27-19-15-11-7-3)75-56-38-28-20-16-12-8-4/h9-16,58,61-62H,5-8,17-57H2,1-4H3,(H2,64,69)/b13-9-,14-10-,15-11-,16-12- |
| InChIKey | KESUAMIALBLYIL-NONDJZLBSA-N |
| XLogP | 14.69 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.62 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|