About ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane
ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane (PubChem CID 164563431) has the molecular formula C19H32N2O6S
and a molecular weight of 416.54 g/mol. Its IUPAC name is ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane.
Molecular Properties
| Compound Name | ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane |
| PubChem CID | 164563431 |
| Molecular Formula | C19H32N2O6S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane |
| SMILES | CC(C)(C)OC(=O)CCC(OC(=O)n1ccnc1)C(=O)OC(C)(C)C.CSC |
| InChI | InChI=1S/C17H26N2O6.C2H6S/c1-16(2,3)24-13(20)8-7-12(14(21)25-17(4,5)6)23-15(22)19-10-9-18-11-19;1-3-2/h9-12H,7-8H2,1-6H3;1-2H3 |
| InChIKey | XWKZJRWDPNKPJX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane?
The IUPAC name of ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane (CID 164563431) is ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane.
What is the SMILES notation for ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane?
The canonical SMILES for ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane is CC(C)(C)OC(=O)CCC(OC(=O)n1ccnc1)C(=O)OC(C)(C)C.CSC.
What is the InChIKey of ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane?
The InChIKey is XWKZJRWDPNKPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O6.C2H6S/c1-16(2,3)24-13(20)8-7-12(14(21)25-17(4,5)6)23-15(22)19-10-9-18-11-19;1-3-2/h9-12H,7-8H2,1-6H3;1-2H3.
What are the key properties of ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane?
ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane has a molecular weight of 416.54 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-(imidazole-1-carbonyloxy)pentanedioate;methylsulfanylmethane is sourced from PubChem (CID 164563431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).