C32H49NO5 — CID 164618529
2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(morpholin-4-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol (PubChem CID 164618529) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(morpholin-4-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol.
| Compound Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(morpholin-4-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 164618529 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(morpholin-4-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
| SMILES | C/C(=C\CC/C(C)=C/CC[C@]1(C)CCc2c(CN3CCOCC3)c(O)cc(C)c2O1)CCC=C(CO)CO |
| InChI | InChI=1S/C32H49NO5/c1-24(10-6-12-27(22-34)23-35)8-5-9-25(2)11-7-14-32(4)15-13-28-29(21-33-16-18-37-19-17-33)30(36)20-26(3)31(28)38-32/h8,11-12,20,34-36H,5-7,9-10,13-19,21-23H2,1-4H3/b24-8+,25-11+/t32-/m1/s1 |
| InChIKey | LECLCKVOPRFEFO-GXPMFIHESA-N |
| XLogP | 5.76 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|