C12H13Cl3N2O3S — CID 164663526
2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-N-(3,5-dichlorophenyl)acetamide (PubChem CID 164663526) has the molecular formula C12H13Cl3N2O3S and a molecular weight of 371.67 g/mol. Its IUPAC name is 2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 164663526 |
| Molecular Formula | C12H13Cl3N2O3S |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-N-(3,5-dichlorophenyl)acetamide |
| SMILES | O=C(CNC1CS(=O)(=O)CC1Cl)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl3N2O3S/c13-7-1-8(14)3-9(2-7)17-12(18)4-16-11-6-21(19,20)5-10(11)15/h1-3,10-11,16H,4-6H2,(H,17,18) |
| InChIKey | GWSYLNAACFKFJQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|