C23H36OSi — CID 164669227
[1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentoxy]-trimethylsilane (PubChem CID 164669227) has the molecular formula C23H36OSi and a molecular weight of 356.63 g/mol. Its IUPAC name is [1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentoxy]-trimethylsilane.
| Compound Name | [1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 164669227 |
| Molecular Formula | C23H36OSi |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | [1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentoxy]-trimethylsilane |
| SMILES | CC1(C)[C@H]2CC=C(C(CCCCc3ccccc3)O[Si](C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C23H36OSi/c1-23(2)19-15-16-20(21(23)17-19)22(24-25(3,4)5)14-10-9-13-18-11-7-6-8-12-18/h6-8,11-12,16,19,21-22H,9-10,13-15,17H2,1-5H3/t19-,21-,22?/m0/s1 |
| InChIKey | IWOBDYGYYZFPMJ-QUCQDJGISA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|