C15H17F2O8S- — CID 164777731
1,1-difluoro-2-[3-(oxetan-3-ylmethoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethanesulfonate (PubChem CID 164777731) has the molecular formula C15H17F2O8S- and a molecular weight of 395.36 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(oxetan-3-ylmethoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[3-(oxetan-3-ylmethoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 164777731 |
| Molecular Formula | C15H17F2O8S- |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1,1-difluoro-2-[3-(oxetan-3-ylmethoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethanesulfonate |
| SMILES | O=C(OCC1COC1)C1C2C=CC(C2)C1C(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H18F2O8S/c16-15(17,26(20,21)22)7-25-14(19)12-10-2-1-9(3-10)11(12)13(18)24-6-8-4-23-5-8/h1-2,8-12H,3-7H2,(H,20,21,22)/p-1 |
| InChIKey | GGGZTRPUAZPOKX-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|