C8H8Br2N2 — CID 164843127
2,4-dibromo-6-(methyliminomethyl)aniline (PubChem CID 164843127) has the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. Its IUPAC name is 2,4-dibromo-6-(methyliminomethyl)aniline.
| Compound Name | 2,4-dibromo-6-(methyliminomethyl)aniline |
|---|---|
| PubChem CID | 164843127 |
| Molecular Formula | C8H8Br2N2 |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.91 |
| IUPAC Name | 2,4-dibromo-6-(methyliminomethyl)aniline |
| SMILES | C/N=C/c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C8H8Br2N2/c1-12-4-5-2-6(9)3-7(10)8(5)11/h2-4H,11H2,1H3/b12-4+ |
| InChIKey | ONTRAVOZRMBLEI-UUILKARUSA-N |
| XLogP | 2.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|