C15H20F2N2 — CID 164923952
(2E,3Z)-6-(2,2-difluoroethyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (PubChem CID 164923952) has the molecular formula C15H20F2N2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2E,3Z)-6-(2,2-difluoroethyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
| Compound Name | (2E,3Z)-6-(2,2-difluoroethyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164923952 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2E,3Z)-6-(2,2-difluoroethyl)-3-ethylidene-5-methyl-2-prop-2-enylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
| SMILES | C=C/C=c1/[nH]c2c(/c1=C/C)CC(C)N(CC(F)F)C2 |
| InChI | InChI=1S/C15H20F2N2/c1-4-6-13-11(5-2)12-7-10(3)19(9-15(16)17)8-14(12)18-13/h4-6,10,15,18H,1,7-9H2,2-3H3/b11-5-,13-6+ |
| InChIKey | BSOZQQFNYKWBDJ-FALRLRKYSA-N |
| XLogP | 1.79 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |