C16H12F11NO3 — CID 165364431
2-[dimethyl-[4-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyphenyl]azaniumyl]acetate (PubChem CID 165364431) has the molecular formula C16H12F11NO3 and a molecular weight of 475.25 g/mol. Its IUPAC name is 2-[dimethyl-[4-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyphenyl]azaniumyl]acetate.
| Compound Name | 2-[dimethyl-[4-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyphenyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 165364431 |
| Molecular Formula | C16H12F11NO3 |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[dimethyl-[4-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyphenyl]azaniumyl]acetate |
| SMILES | C[N+](C)(CC(=O)[O-])c1ccc(OC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F11NO3/c1-28(2,7-10(29)30)8-3-5-9(6-4-8)31-12(13(17,18)16(25,26)27)11(14(19,20)21)15(22,23)24/h3-6H,7H2,1-2H3 |
| InChIKey | WASXGDHAJUFQNQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|