C24H29N3O3S2 — CID 16547378
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-(2-methoxyethyl)butanamide (PubChem CID 16547378) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 16547378 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-(2-methoxyethyl)butanamide |
| SMILES | COCCN(CC(=O)Nc1cccc(C)c1C)C(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-17-8-6-10-19(18(17)2)25-22(28)16-27(13-14-30-3)23(29)12-7-15-31-24-26-20-9-4-5-11-21(20)32-24/h4-6,8-11H,7,12-16H2,1-3H3,(H,25,28) |
| InChIKey | JDRAJOUNLDNNDU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|