C27H27FN4O4 — CID 166061246
3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]-1H-indole-7-carboxamide (PubChem CID 166061246) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]-1H-indole-7-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 166061246 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-fluoro-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]-1H-indole-7-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(c2c(F)cc(C(N)=O)c3[nH]cc(C#Cc4cc(OC)cc(OC)c4)c23)C1 |
| InChI | InChI=1S/C27H27FN4O4/c1-4-23(33)31-18-6-5-9-32(15-18)26-22(28)13-21(27(29)34)25-24(26)17(14-30-25)8-7-16-10-19(35-2)12-20(11-16)36-3/h4,10-14,18,30H,1,5-6,9,15H2,2-3H3,(H2,29,34)(H,31,33)/t18-/m0/s1 |
| InChIKey | VXDQCVSJXNPTRF-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|