C10H19LrN2O- — CID 166075419
CID 166075419 (PubChem CID 166075419) has the molecular formula C10H19LrN2O- and a molecular weight of 445.28 g/mol.
| Compound Name | CID 166075419 |
|---|---|
| PubChem CID | 166075419 |
| Molecular Formula | C10H19LrN2O- |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | — |
| SMILES | C[C-]1CC(C)(C)CC(C)NC(=O)N1.[Lr] |
| InChI | InChI=1S/C10H19N2O.Lr/c1-7-5-10(3,4)6-8(2)12-9(13)11-7;/h7H,5-6H2,1-4H3,(H2,11,12,13);/q-1; |
| InChIKey | RVJATHLDZQYOJF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|