C15H17FN3O4+ — CID 166077513
N-(2,6-dioxopiperidin-3-yl)-6-fluoro-9,9-dimethyl-8-oxa-9-azoniabicyclo[5.2.0]nona-1,3,5-triene-4-carboxamide (PubChem CID 166077513) has the molecular formula C15H17FN3O4+ and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-6-fluoro-9,9-dimethyl-8-oxa-9-azoniabicyclo[5.2.0]nona-1,3,5-triene-4-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-6-fluoro-9,9-dimethyl-8-oxa-9-azoniabicyclo[5.2.0]nona-1,3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 166077513 |
| Molecular Formula | C15H17FN3O4+ |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-6-fluoro-9,9-dimethyl-8-oxa-9-azoniabicyclo[5.2.0]nona-1,3,5-triene-4-carboxamide |
| SMILES | C[N+]1(C)OC2C(F)=CC(C(=O)NC3CCC(=O)NC3=O)=CC=C21 |
| InChI | InChI=1S/C15H16FN3O4/c1-19(2)11-5-3-8(7-9(16)13(11)23-19)14(21)17-10-4-6-12(20)18-15(10)22/h3,5,7,10,13H,4,6H2,1-2H3,(H-,17,18,20,21,22)/p+1 |
| InChIKey | SZHVKJKGEXGMMP-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|