C20H34N2O3 — CID 166130917
4-N-(2-hydroxyethyl)benzene-1,4-dicarboxamide;2,3,3,5-tetramethylhexane (PubChem CID 166130917) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 4-N-(2-hydroxyethyl)benzene-1,4-dicarboxamide;2,3,3,5-tetramethylhexane.
| Compound Name | 4-N-(2-hydroxyethyl)benzene-1,4-dicarboxamide;2,3,3,5-tetramethylhexane |
|---|---|
| PubChem CID | 166130917 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 4-N-(2-hydroxyethyl)benzene-1,4-dicarboxamide;2,3,3,5-tetramethylhexane |
| SMILES | CC(C)CC(C)(C)C(C)C.NC(=O)c1ccc(C(=O)NCCO)cc1 |
| InChI | InChI=1S/C10H12N2O3.C10H22/c11-9(14)7-1-3-8(4-2-7)10(15)12-5-6-13;1-8(2)7-10(5,6)9(3)4/h1-4,13H,5-6H2,(H2,11,14)(H,12,15);8-9H,7H2,1-6H3 |
| InChIKey | WHSJBPDAVFELDI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |