About 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide
7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide (PubChem CID 166137935) has the molecular formula C8H8BrNO2S
and a molecular weight of 262.13 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide.
Analyze 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide?
The IUPAC name of 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide (CID 166137935) is 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide.
What is the SMILES notation for 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide?
The canonical SMILES for 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide is O=S1NCCOc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide?
The InChIKey is UWENZDUXWQCDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2S/c9-6-1-2-8-7(5-6)12-4-3-10-13(8)11/h1-2,5,10H,3-4H2.
What are the key properties of 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide?
7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide has a molecular weight of 262.13 g/mol, XLogP of 1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,4-dihydro-2H-5,1λ4,2-benzoxathiazepine 1-oxide is sourced from PubChem (CID 166137935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).