C14H21IN2O3 — CID 166392860
(4-iodo-5-methyl-1,2-oxazol-3-yl)methyl N-(3,3-dimethylhex-5-enyl)carbamate (PubChem CID 166392860) has the molecular formula C14H21IN2O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is (4-iodo-5-methyl-1,2-oxazol-3-yl)methyl N-(3,3-dimethylhex-5-enyl)carbamate.
| Compound Name | (4-iodo-5-methyl-1,2-oxazol-3-yl)methyl N-(3,3-dimethylhex-5-enyl)carbamate |
|---|---|
| PubChem CID | 166392860 |
| Molecular Formula | C14H21IN2O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (4-iodo-5-methyl-1,2-oxazol-3-yl)methyl N-(3,3-dimethylhex-5-enyl)carbamate |
| SMILES | C=CCC(C)(C)CCNC(=O)OCc1noc(C)c1I |
| InChI | InChI=1S/C14H21IN2O3/c1-5-6-14(3,4)7-8-16-13(18)19-9-11-12(15)10(2)20-17-11/h5H,1,6-9H2,2-4H3,(H,16,18) |
| InChIKey | SOYMJLJAMHTTTJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|