C28H27F7N4O3 — CID 166401604
2-fluoro-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-4-[3-(trifluoromethyl)phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 166401604) has the molecular formula C28H27F7N4O3 and a molecular weight of 600.54 g/mol. Its IUPAC name is 2-fluoro-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-4-[3-(trifluoromethyl)phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-fluoro-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-4-[3-(trifluoromethyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166401604 |
| Molecular Formula | C28H27F7N4O3 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2-fluoro-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-4-[3-(trifluoromethyl)phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCCN1CCN(c2ccncc2)CC1)c1ccc(-c2cccc(C(F)(F)F)c2)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26F4N4O.C2HF3O2/c27-24-18-20(19-3-1-4-21(17-19)26(28,29)30)5-6-23(24)25(35)32-9-2-12-33-13-15-34(16-14-33)22-7-10-31-11-8-22;3-2(4,5)1(6)7/h1,3-8,10-11,17-18H,2,9,12-16H2,(H,32,35);(H,6,7) |
| InChIKey | HHFOXHWFDGMMPN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|