C27H46O3Si — CID 166444580
1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 166444580) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 166444580 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCCCC[C@@H](C)[C@@H]1C=C[C@H]2[C@@H](CCC[C@H]2OCOC)[C@]1(C)C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C27H46O3Si/c1-8-9-10-11-13-21(2)23-17-16-22-24(14-12-15-25(22)30-20-29-4)27(23,3)26(28)18-19-31(5,6)7/h16-17,21-25H,8-15,20H2,1-7H3/t21-,22+,23+,24-,25-,27-/m1/s1 |
| InChIKey | NOEYHRMHLMZMMS-VBIGLTOZSA-N |
| XLogP | 6.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|