C21H31NO — CID 166446685
(3S)-3-[(4R)-4,8-dimethylnon-7-enyl]-1,3-dimethylindol-2-one (PubChem CID 166446685) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (3S)-3-[(4R)-4,8-dimethylnon-7-enyl]-1,3-dimethylindol-2-one.
| Compound Name | (3S)-3-[(4R)-4,8-dimethylnon-7-enyl]-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 166446685 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (3S)-3-[(4R)-4,8-dimethylnon-7-enyl]-1,3-dimethylindol-2-one |
| SMILES | CC(C)=CCC[C@H](C)CCC[C@]1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H31NO/c1-16(2)10-8-11-17(3)12-9-15-21(4)18-13-6-7-14-19(18)22(5)20(21)23/h6-7,10,13-14,17H,8-9,11-12,15H2,1-5H3/t17-,21-/m0/s1 |
| InChIKey | RVZOLPJJGVPSLE-UWJYYQICSA-N |
| XLogP | 5.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|